ChemNet > CAS > 129-94-2 2-(8-Chloro-1-naphthylthio)acetic acid
129-94-2 2-(8-Chloro-1-naphthylthio)acetic acid
| Nazwa produktu: |
2-(8-Chloro-1-naphthylthio)acetic acid |
| Synonimy |
2-[(8-Chloro-1-naphthyl)thio]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetate |
| MF |
C12H8ClO2S |
| Masie cząsteczkowej |
251.7093 |
| InChI |
InChI=1/C12H9ClO2S/c13-9-5-1-3-8-4-2-6-10(12(8)9)16-7-11(14)15/h1-6H,7H2,(H,14,15)/p-1 |
| Nr CAS |
129-94-2 |
| EINECS |
204-971-3 |
| Struktury molekularnej |
|
| Temperatura topnienia |
155-157℃ |
| Temperatura wrzenia |
450.1°C at 760 mmHg |
| Temperatura zapłonu |
226°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
