ChemNet > CAS > 135-01-3 1,2-diethylbenzene
135-01-3 1,2-diethylbenzene
Nazwa produktu: |
1,2-diethylbenzene |
Synonimy |
Diethylbenzene; o-Diethylbenzene |
MF |
C10H14 |
Masie cząsteczkowej |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
Nr CAS |
135-01-3 |
EINECS |
205-170-1 |
Struktury molekularnej |
|
Gęstość |
0.865g/cm3 |
Temperatura wrzenia |
183.5°C at 760 mmHg |
Współczynnik załamania |
1.496 |
Temperatura zapłonu |
49.4°C |
Symbole zagrożenia |
|
Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|