ChemNet > CAS > 1556-18-9 Iodocyclopentane
1556-18-9 Iodocyclopentane
| Nazwa produktu: |
Iodocyclopentane |
| Synonimy |
Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
| MF |
C8H7NOS |
| Masie cząsteczkowej |
165.2123 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| Nr CAS |
1556-18-9 |
| EINECS |
216-311-1 |
| Struktury molekularnej |
|
| Gęstość |
1.08g/cm3 |
| Temperatura wrzenia |
280.5°C at 760 mmHg |
| Współczynnik załamania |
1.551 |
| Temperatura zapłonu |
123.4°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
