ChemNet > CAS > 1577-22-6 5-Hexenoic acid
1577-22-6 5-Hexenoic acid
Nazwa produktu: |
5-Hexenoic acid |
Synonimy |
hex-5-enoic acid |
MF |
C6H10O2 |
Masie cząsteczkowej |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) |
Nr CAS |
1577-22-6 |
Struktury molekularnej |
|
Gęstość |
0.973g/cm3 |
Temperatura wrzenia |
202.6°C at 760 mmHg |
Współczynnik załamania |
1.443 |
Temperatura zapłonu |
100.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|