ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
Nazwa produktu: |
Diethyl phenylphosphonite |
Synonimy |
Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
MF |
C10H15O2P |
Masie cząsteczkowej |
198.1987 |
InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
Nr CAS |
1638-86-4 |
EINECS |
216-676-7 |
Struktury molekularnej |
|
Temperatura wrzenia |
235°C at 760 mmHg |
Temperatura zapłonu |
113°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|