ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
Nazwa produktu: |
2,3-Dichlorothiophene |
Synonimy |
2,3-dichloro-thiophene |
MF |
C4H2Cl2S |
Masie cząsteczkowej |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
Nr CAS |
17249-79-5;17249-29-5 |
Struktury molekularnej |
|
Gęstość |
1.488g/cm3 |
Temperatura topnienia |
-26℃ |
Temperatura wrzenia |
170.7°C at 760 mmHg |
Współczynnik załamania |
1.584 |
Temperatura zapłonu |
68.9°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|