ChemNet > CAS > 175277-98-2 2,4-Dichloro-6-methylbenzonitrile
175277-98-2 2,4-Dichloro-6-methylbenzonitrile
| Nazwa produktu: |
2,4-Dichloro-6-methylbenzonitrile |
| Synonimy |
4,6-Dichloro-o-tolunitrile |
| MF |
C8H5Cl2N |
| Masie cząsteczkowej |
186.038 |
| InChI |
InChI=1/C8H5Cl2N/c1-5-2-6(9)3-8(10)7(5)4-11/h2-3H,1H3 |
| Nr CAS |
175277-98-2 |
| Struktury molekularnej |
|
| Gęstość |
1.34g/cm3 |
| Temperatura wrzenia |
287°C at 760 mmHg |
| Współczynnik załamania |
1.572 |
| Temperatura zapłonu |
124.1°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
