ChemNet > CAS > 17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
Nazwa produktu: |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
MF |
C10H7Cl2NS |
Masie cząsteczkowej |
244.1403 |
InChI |
InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
Nr CAS |
17969-22-1 |
Struktury molekularnej |
|
Gęstość |
1.378g/cm3 |
Temperatura topnienia |
78℃ |
Temperatura wrzenia |
374°C at 760 mmHg |
Współczynnik załamania |
1.617 |
Temperatura zapłonu |
180°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|