ChemNet > CAS > 20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
Nazwa produktu: |
2-phenyl-1,3-thiazole-4-carbaldehyde |
Synonimy |
2-phenylthiazole-4-carbaldehyde |
MF |
C10H7NOS |
Masie cząsteczkowej |
189.2337 |
InChI |
InChI=1/C10H7NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-7H |
Nr CAS |
20949-81-9 |
Struktury molekularnej |
|
Gęstość |
1.269g/cm3 |
Temperatura topnienia |
45℃ |
Temperatura wrzenia |
353°C at 760 mmHg |
Współczynnik załamania |
1.645 |
Temperatura zapłonu |
167.3°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|