ChemNet > CAS > 22446-12-4 4-Methoxyphenoxyacetonitrile
22446-12-4 4-Methoxyphenoxyacetonitrile
Nazwa produktu: |
4-Methoxyphenoxyacetonitrile |
MF |
C9H9NO2 |
Masie cząsteczkowej |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-2-4-9(5-3-8)12-7-6-10/h2-5H,7H2,1H3 |
Nr CAS |
22446-12-4 |
Struktury molekularnej |
|
Gęstość |
1.107g/cm3 |
Temperatura wrzenia |
293.8°C at 760 mmHg |
Współczynnik załamania |
1.511 |
Temperatura zapłonu |
122.1°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|