ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
| Nazwa produktu: |
Phenanthridine |
| Synonimy |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| MF |
C13H9N |
| Masie cząsteczkowej |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| Nr CAS |
229-87-8 |
| EINECS |
205-934-4 |
| Struktury molekularnej |
|
| Gęstość |
1.187g/cm3 |
| Temperatura topnienia |
104-107℃ |
| Temperatura wrzenia |
340.8°C at 760 mmHg |
| Współczynnik załamania |
1.726 |
| Temperatura zapłonu |
155.9°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
