ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
Nazwa produktu: |
Phenanthridine |
Synonimy |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
MF |
C13H9N |
Masie cząsteczkowej |
179.2173 |
InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
Nr CAS |
229-87-8 |
EINECS |
205-934-4 |
Struktury molekularnej |
|
Gęstość |
1.187g/cm3 |
Temperatura topnienia |
104-107℃ |
Temperatura wrzenia |
340.8°C at 760 mmHg |
Współczynnik załamania |
1.726 |
Temperatura zapłonu |
155.9°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|