ChemNet > CAS > 26475-66-1 4-Benzylthiomorpholine 1,1-Dioxide
26475-66-1 4-Benzylthiomorpholine 1,1-Dioxide
Nazwa produktu: |
4-Benzylthiomorpholine 1,1-Dioxide |
Synonimy |
4-Benzylthiomorpholine 1,1-Dioxide; thiomorpholine, 4-(phenylmethyl)-, 1,1-dioxide |
MF |
C11H15NO2S |
Masie cząsteczkowej |
225.3073 |
InChI |
InChI=1/C11H15NO2S/c13-15(14)8-6-12(7-9-15)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
Nr CAS |
26475-66-1 |
Struktury molekularnej |
|
Gęstość |
1.235g/cm3 |
Temperatura topnienia |
83℃ |
Temperatura wrzenia |
397.9°C at 760 mmHg |
Współczynnik załamania |
1.578 |
Temperatura zapłonu |
194.4°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|