ChemNet > CAS > 2694-54-4 Triallyl Trimellitate
2694-54-4 Triallyl Trimellitate
Nazwa produktu: |
Triallyl Trimellitate |
Synonimy |
1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
MF |
C18H18O6 |
Masie cząsteczkowej |
330.3319 |
InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
Nr CAS |
2694-54-4 |
EINECS |
220-264-2 |
Struktury molekularnej |
|
Gęstość |
1.149g/cm3 |
Temperatura wrzenia |
438.1°C at 760 mmHg |
Współczynnik załamania |
1.528 |
Temperatura zapłonu |
191.3°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|