ChemNet > CAS > 3066-71-5 Cyclohexyl acrylate
3066-71-5 Cyclohexyl acrylate
| Nazwa produktu: |
Cyclohexyl acrylate |
| Synonimy |
Cyclohexyl acrylate,(Acrylic acid cyclohexyl ester); Acrylic acid cyclohexyl ester; cyclohexyl prop-2-enoate; 2-cyclohexylprop-2-enoate |
| MF |
C9H13O2 |
| Masie cząsteczkowej |
153.1989 |
| InChI |
InChI=1/C9H14O2/c1-7(9(10)11)8-5-3-2-4-6-8/h8H,1-6H2,(H,10,11)/p-1 |
| Nr CAS |
3066-71-5 |
| EINECS |
221-319-3 |
| Struktury molekularnej |
|
| Temperatura wrzenia |
283.7°C at 760 mmHg |
| Temperatura zapłonu |
189.9°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R37/38:Irritating to respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Bezpieczeństwo opis |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
