ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
| Nazwa produktu: |
2-Acetyl-5-iodothiophene |
| Synonimy |
NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| MF |
C6H5IOS |
| Masie cząsteczkowej |
252.0728 |
| InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| Nr CAS |
30955-94-3 |
| Struktury molekularnej |
|
| Gęstość |
1.902g/cm3 |
| Temperatura wrzenia |
306.2°C at 760 mmHg |
| Współczynnik załamania |
1.637 |
| Temperatura zapłonu |
139°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
