ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
Nazwa produktu: |
2-Acetyl-5-iodothiophene |
Synonimy |
NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
MF |
C6H5IOS |
Masie cząsteczkowej |
252.0728 |
InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
Nr CAS |
30955-94-3 |
Struktury molekularnej |
|
Gęstość |
1.902g/cm3 |
Temperatura wrzenia |
306.2°C at 760 mmHg |
Współczynnik załamania |
1.637 |
Temperatura zapłonu |
139°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|