ChemNet > CAS > 332-43-4 1-(2-chloroethyl)-4-fluorobenzene
332-43-4 1-(2-chloroethyl)-4-fluorobenzene
Nazwa produktu: |
1-(2-chloroethyl)-4-fluorobenzene |
Synonimy |
4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
MF |
C8H8ClF |
Masie cząsteczkowej |
158.6005 |
InChI |
InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
Nr CAS |
332-43-4 |
EINECS |
206-364-9 |
Struktury molekularnej |
|
Gęstość |
1.15g/cm3 |
Temperatura wrzenia |
204.6°C at 760 mmHg |
Współczynnik załamania |
1.501 |
Temperatura zapłonu |
79.9°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|