ChemNet > CAS > 3508-94-9 alpha-Isopropylphenylacetic acid
3508-94-9 alpha-Isopropylphenylacetic acid
Nazwa produktu: |
alpha-Isopropylphenylacetic acid |
Synonimy |
3-Methyl-2-phenylbutyric acid; 3-methyl-2-phenylbutanoic acid; (2S)-3-methyl-2-phenylbutanoate |
MF |
C11H13O2 |
Masie cząsteczkowej |
177.2203 |
InChI |
InChI=1/C11H14O2/c1-8(2)10(11(12)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13)/p-1/t10-/m0/s1 |
Nr CAS |
3508-94-9 |
Struktury molekularnej |
|
Temperatura wrzenia |
282°C at 760 mmHg |
Temperatura zapłonu |
179.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|