ChemNet > CAS > 3693-53-6 Diethyl methylenedicarbamate
3693-53-6 Diethyl methylenedicarbamate
Nazwa produktu: |
Diethyl methylenedicarbamate |
Synonimy |
Methylene diurethane; diethyl methanediylbiscarbamate |
MF |
C7H14N2O4 |
Masie cząsteczkowej |
190.1971 |
InChI |
InChI=1/C7H14N2O4/c1-3-12-6(10)8-5-9-7(11)13-4-2/h3-5H2,1-2H3,(H,8,10)(H,9,11) |
Nr CAS |
3693-53-6 |
EINECS |
223-011-4 |
Struktury molekularnej |
|
Gęstość |
1.127g/cm3 |
Temperatura wrzenia |
326.2°C at 760 mmHg |
Współczynnik załamania |
1.448 |
Temperatura zapłonu |
151.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|