ChemNet > CAS > 38291-82-6 Valeric acid hydrazide
38291-82-6 Valeric acid hydrazide
Nazwa produktu: |
Valeric acid hydrazide |
Synonimy |
Pentanoic acid hydrazide; pentanehydrazide |
MF |
C5H12N2O |
Masie cząsteczkowej |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
Nr CAS |
38291-82-6 |
EINECS |
253-864-8 |
Struktury molekularnej |
|
Gęstość |
0.962g/cm3 |
Temperatura wrzenia |
260.6°C at 760 mmHg |
Współczynnik załamania |
1.449 |
Temperatura zapłonu |
111.4°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|