ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
Nazwa produktu: |
2-aminothiophene-3-carbonitrile |
Synonimy |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
MF |
C5H4N2S |
Masie cząsteczkowej |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
Nr CAS |
4651-82-5 |
Struktury molekularnej |
|
Gęstość |
1.33g/cm3 |
Temperatura topnienia |
104℃ |
Temperatura wrzenia |
317.5°C at 760 mmHg |
Współczynnik załamania |
1.627 |
Temperatura zapłonu |
145.8°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|