ChemNet > CAS > 52805-36-4 4-Benzyloxybenzonitrile
52805-36-4 4-Benzyloxybenzonitrile
Nazwa produktu: |
4-Benzyloxybenzonitrile |
MF |
C14H11NO |
Masie cząsteczkowej |
209.2432 |
InChI |
InChI=1/C14H11NO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,11H2 |
Nr CAS |
52805-36-4 |
Struktury molekularnej |
|
Gęstość |
1.14g/cm3 |
Temperatura wrzenia |
374°C at 760 mmHg |
Współczynnik załamania |
1.597 |
Temperatura zapłonu |
157.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|