Nazwa produktu: |
D-glucitol, etoksylowany i propoksylowany (1 - 12,5 mola etoksylowanego i 1-12,5 mola propoksylowanego) |
Synonimy |
polioksyetylen (245) polioksypropylen (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; polioksyetyleno(500)polioksypropylen (6) sorbitol; polioksypropylen (6) polioksyetylen (245) sorbitol; polioksypropylen (6) polioksyetylen (500) sorbitol; Poli(oksy(metylo-1,2-etanodiylo)oksy-1,2-etanodiyl), D-glucitol; Oksyran, 2-metylo-, polimer z oksiranem, eter z D-glucitolem (6:1); Oksiran metylo-, polimer z oksiranem, eter z D-glucitolem (6:1); (2R,3R,4R,5S)-heksano-1,2,3,4,5,6-heksol; 2-metyloksiran; oksiran |
Angielska nazwa |
D-Glucitol, ethoxylated and propoxylated (1 - 12.5 moles ethoxylated and 1 - 12.5 moles propoxylated);Polyoxyethylene (245) polyoxypropylene (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoxyethylene (500) polyoxypropylene (6) sorbitol; Polyoxypropylene (6) polyoxyethylene (245) sorbitol; Polyoxypropylene (6) polyoxyethylene (500) sorbitol; Poly(oxy(methyl-1,2-ethanediyl)oxy-1,2-ethanediyl), D-glucitol; Oxirane, 2-methyl-, polymer with oxirane, ether with D-glucitol (6:1); Oxirane, methyl-, polymer with oxirane, ether with D-glucitol (6:1); (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol; 2-methyloxirane; oxirane |
MF |
C36H74O18 |
Masie cząsteczkowej |
794.962 |
InChI |
InChI=1/C6H14O6.6C3H6O.6C2H4O/c7-1-3(9)5(11)6(12)4(10)2-8;6*1-3-2-4-3;6*1-2-3-1/h3-12H,1-2H2;6*3H,2H2,1H3;6*1-2H2/t3-,4+,5-,6-;;;;;;;;;;;;/m1............/s1 |
Nr CAS |
56449-05-9 |
EINECS |
500-132-3 |
Struktury molekularnej |
|
Temperatura wrzenia |
494.9°C at 760 mmHg |
Temperatura zapłonu |
292.6°C |
Ciśnienie pary |
7.22E-12mmHg at 25°C |
|