610-69-5 octan 2-nitrofenylu
Nazwa produktu: |
octan 2-nitrofenylu |
Synonimy |
octan 2-nitrofenylu; ester 2-nitrofenylowy kwasu octowego |
Angielska nazwa |
2-nitrophenyl acetate; 2-Nitrophenyl acetate; Acetic acid 2-nitrophenyl ester |
MF |
C8H7NO4 |
Masie cząsteczkowej |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
Nr CAS |
610-69-5 |
EINECS |
210-233-1 |
Struktury molekularnej |
|
Gęstość |
1.304g/cm3 |
Temperatura topnienia |
39-41℃ |
Temperatura wrzenia |
274.8°C at 760 mmHg |
Współczynnik załamania |
1.548 |
Temperatura zapłonu |
139.8°C |
Ciśnienie pary |
0.00528mmHg at 25°C |
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|