ChemNet > CAS > 766-39-2 2,3-Dimethylmaleic anhydride
766-39-2 2,3-Dimethylmaleic anhydride
Nazwa produktu: |
2,3-Dimethylmaleic anhydride |
Synonimy |
3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione; 4,5-Dimethyl-1,3-Dioxa-2-Oxo-Cyclopentene |
MF |
C6H6O3 |
Masie cząsteczkowej |
126.11 |
InChI |
InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
Nr CAS |
766-39-2 |
EINECS |
212-165-8 |
Struktury molekularnej |
|
Gęstość |
1.236g/cm3 |
Temperatura topnienia |
93-96℃ |
Temperatura wrzenia |
223°C at 760 mmHg |
Współczynnik załamania |
1.486 |
Temperatura zapłonu |
95.6°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|