CAS No: 76784-95-7, Chemical Name: (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid
the physical and chemical property of 76784-95-7, (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid is provided by ChemNet.com
ChemNet > CAS > 76784-95-7 (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid
76784-95-7 (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid
| Nazwa produktu: |
(1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid |
| Synonimy |
1,2,4-Cyclohexanetricarboxylicacid, (1a,2a,4a)- |
| MF |
C9H12O6 |
| Masie cząsteczkowej |
216.188 |
| InChI |
InChI=1/C9H12O6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15) |
| Nr CAS |
76784-95-7 |
| Struktury molekularnej |
|
| Gęstość |
1.509g/cm3 |
| Temperatura wrzenia |
470.1°C at 760 mmHg |
| Współczynnik załamania |
1.555 |
| Temperatura zapłonu |
252.2°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
|
|
