ChemNet > CAS > 871-78-3 N,N'-Diacetylethylenediamine
871-78-3 N,N'-Diacetylethylenediamine
Nazwa produktu: |
N,N'-Diacetylethylenediamine |
Synonimy |
N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
MF |
C6H12N2O2 |
Masie cząsteczkowej |
144.1717 |
InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
Nr CAS |
871-78-3 |
EINECS |
212-811-9 |
Struktury molekularnej |
|
Gęstość |
1.033g/cm3 |
Temperatura wrzenia |
438.7°C at 760 mmHg |
Współczynnik załamania |
1.444 |
Temperatura zapłonu |
214.8°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|