ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
| Nazwa produktu: |
Diallyl maleate |
| Synonimy |
Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
| MF |
C10H12O4 |
| Masie cząsteczkowej |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
| Nr CAS |
999-21-3 |
| EINECS |
213-658-0 |
| Struktury molekularnej |
|
| Gęstość |
1.064g/cm3 |
| Temperatura wrzenia |
263.7°C at 760 mmHg |
| Współczynnik załamania |
1.469 |
| Temperatura zapłonu |
124.6°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
