ChemNet > CAS > 10352-88-2 trans-2-Heptenoic acid
10352-88-2 trans-2-Heptenoic acid
| Nome do produto |
trans-2-Heptenoic acid |
| Sinônimos |
Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
| Fórmula molecular |
C7H12O2 |
| Peso Molecular |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
| CAS Registry Number |
10352-88-2 |
| EINECS |
233-769-8 |
| Estrutura Molecular |
|
| Densidade |
0.968g/cm3 |
| Ponto de ebulição |
226.6°C at 760 mmHg |
| índice de refração |
1.457 |
| O ponto de inflamação |
133.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
