ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
| Nome do produto |
1-Piperidinethiocarboxamide |
| Sinônimos |
piperidine-1-carbothioamide |
| Fórmula molecular |
C6H12N2S |
| Peso Molecular |
144.2379 |
| InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
| CAS Registry Number |
14294-09-8 |
| Estrutura Molecular |
|
| Densidade |
1.165g/cm3 |
| Ponto de ebulição |
237.3°C at 760 mmHg |
| índice de refração |
1.593 |
| O ponto de inflamação |
97.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
R20/22:Harmful by inhalation and if swallowed.;
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
