ChemNet > CAS > 1457-85-8 Ethyl oxanilate
1457-85-8 Ethyl oxanilate
| Nome do produto |
Ethyl oxanilate |
| Sinônimos |
Oxanilic acid ethyl ester; ethyl oxo(phenylamino)acetate |
| Fórmula molecular |
C10H11NO3 |
| Peso Molecular |
193.1992 |
| InChI |
InChI=1/C10H11NO3/c1-2-14-10(13)9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,12) |
| CAS Registry Number |
1457-85-8 |
| EINECS |
215-945-6 |
| Estrutura Molecular |
|
| Densidade |
1.215g/cm3 |
| Ponto de fusão |
66-70℃ |
| índice de refração |
1.561 |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
