ChemNet > CAS > 17153-21-8 3-methyl-5-phenyl-4-isoxazolecarboxylic acid
17153-21-8 3-methyl-5-phenyl-4-isoxazolecarboxylic acid
| Nome do produto |
3-methyl-5-phenyl-4-isoxazolecarboxylic acid |
| Sinônimos |
3-methyl-5-phenylisoxazole-4-carboxylic acid |
| Fórmula molecular |
C11H9NO3 |
| Peso Molecular |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-7-9(11(13)14)10(15-12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
| CAS Registry Number |
17153-21-8 |
| Estrutura Molecular |
|
| Densidade |
1.274g/cm3 |
| Ponto de fusão |
191℃ |
| Ponto de ebulição |
362.079°C at 760 mmHg |
| índice de refração |
1.579 |
| O ponto de inflamação |
172.779°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
