ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
| Nome do produto |
ethyl 2-methylnicotinate |
| Sinônimos |
Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
| Fórmula molecular |
C9H11NO2 |
| Peso Molecular |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
| CAS Registry Number |
1721-26-2 |
| EINECS |
217-013-4 |
| Estrutura Molecular |
|
| Densidade |
1.077g/cm3 |
| Ponto de ebulição |
234.7°C at 760 mmHg |
| índice de refração |
1.506 |
| O ponto de inflamação |
86°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
