ChemNet > CAS > 177756-62-6 3-Fluoro-4-methylbenzaldehyde
177756-62-6 3-Fluoro-4-methylbenzaldehyde
| Nome do produto |
3-Fluoro-4-methylbenzaldehyde |
| Sinônimos |
3-Fluoro-p-tolualdehyde |
| Fórmula molecular |
C8H7FO |
| Peso Molecular |
138.139 |
| InChI |
InChI=1/C8H7FO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
| CAS Registry Number |
177756-62-6 |
| Estrutura Molecular |
|
| Densidade |
1.136g/cm3 |
| Ponto de ebulição |
198.3°C at 760 mmHg |
| índice de refração |
1.534 |
| O ponto de inflamação |
80.1°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
