ChemNet > CAS > 2088-24-6 3-Methoxyphenoxyacetic acid
2088-24-6 3-Methoxyphenoxyacetic acid
| Nome do produto |
3-Methoxyphenoxyacetic acid |
| Sinônimos |
Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
| Fórmula molecular |
C9H10O4 |
| Peso Molecular |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| CAS Registry Number |
2088-24-6 |
| Estrutura Molecular |
|
| Densidade |
1.226g/cm3 |
| Ponto de ebulição |
325.9°C at 760 mmHg |
| índice de refração |
1.528 |
| O ponto de inflamação |
131.9°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
