ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
| Nome do produto |
1,3-Difluoro-5-iodobenzene |
| Sinônimos |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
| Fórmula molecular |
C6H3F2I |
| Peso Molecular |
239.9893 |
| InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| CAS Registry Number |
2265-91-0 |
| Estrutura Molecular |
|
| Densidade |
2.001g/cm3 |
| Ponto de ebulição |
173.9°C at 760 mmHg |
| índice de refração |
1.566 |
| O ponto de inflamação |
63.8°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
