ChemNet > CAS > 2338-71-8 5-fluoroindole-3-carboxaldehyde
2338-71-8 5-fluoroindole-3-carboxaldehyde
| Nome do produto |
5-fluoroindole-3-carboxaldehyde |
| Sinônimos |
5-Fluoro-3-formylindole; 5-fluoro-1H-indole-3-carbaldehyde |
| Fórmula molecular |
C9H6FNO |
| Peso Molecular |
163.1484 |
| InChI |
InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
| CAS Registry Number |
2338-71-8 |
| Estrutura Molecular |
|
| Densidade |
1.385g/cm3 |
| Ponto de ebulição |
342.4°C at 760 mmHg |
| índice de refração |
1.695 |
| O ponto de inflamação |
160.9°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
