ChemNet > CAS > 2516-05-4 Methylene Violet (Bernthsen)
2516-05-4 Methylene Violet (Bernthsen)
| Nome do produto |
Methylene Violet (Bernthsen) |
| Sinônimos |
C.I. 52041; Methylene Violet; 7-(dimethylamino)-3H-phenothiazin-3-one |
| Fórmula molecular |
C14H12N2OS |
| Peso Molecular |
256.3229 |
| InChI |
InChI=1/C14H12N2OS/c1-16(2)9-3-5-11-13(7-9)18-14-8-10(17)4-6-12(14)15-11/h3-8H,1-2H3 |
| CAS Registry Number |
2516-05-4 |
| EINECS |
219-733-4 |
| Estrutura Molecular |
|
| Densidade |
1.29g/cm3 |
| Ponto de fusão |
216℃ |
| Ponto de ebulição |
429.6°C at 760 mmHg |
| índice de refração |
1.678 |
| O ponto de inflamação |
213.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
