ChemNet > CAS > 2619-88-7 Palmiticacidhydrazide
2619-88-7 Palmiticacidhydrazide
| Nome do produto |
Palmiticacidhydrazide |
| Sinônimos |
Hexadecanehydrazide; hexadecanoic acid, hydrazide |
| Fórmula molecular |
C16H34N2O |
| Peso Molecular |
270.454 |
| InChI |
InChI=1/C16H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(19)18-17/h2-15,17H2,1H3,(H,18,19) |
| CAS Registry Number |
2619-88-7 |
| Estrutura Molecular |
|
| Densidade |
0.894g/cm3 |
| Ponto de ebulição |
416.2°C at 760 mmHg |
| índice de refração |
1.463 |
| O ponto de inflamação |
205.5°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
