CAS No: 35423-09-7, Chemical Name: (4Z)-4-(phenylmethylidene)-5,6,7,8-tetrahydroisoquinoline-1,3(2H,4H)-dione
the physical and chemical property of 35423-09-7, (4Z)-4-(phenylmethylidene)-5,6,7,8-tetrahydroisoquinoline-1,3(2H,4H)-dione is provided by ChemNet.com
ChemNet > CAS > 35423-09-7 (4Z)-4-(phenylmethylidene)-5,6,7,8-tetrahydroisoquinoline-1,3(2H,4H)-dione
35423-09-7 (4Z)-4-(phenylmethylidene)-5,6,7,8-tetrahydroisoquinoline-1,3(2H,4H)-dione
| Nome do produto |
(4Z)-4-(phenylmethylidene)-5,6,7,8-tetrahydroisoquinoline-1,3(2H,4H)-dione |
| Sinônimos |
|
| Fórmula molecular |
C16H15NO2 |
| Peso Molecular |
253.2958 |
| InChI |
InChI=1/C16H15NO2/c18-15-13-9-5-4-8-12(13)14(16(19)17-15)10-11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2,(H,17,18,19)/b14-10- |
| CAS Registry Number |
35423-09-7 |
| Estrutura Molecular |
|
| Densidade |
1.23g/cm3 |
| Ponto de ebulição |
466°C at 760 mmHg |
| índice de refração |
1.621 |
| O ponto de inflamação |
186.7°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
|
|
