ChemNet > CAS > 536-89-0 m-Tolylhydrazine
536-89-0 m-Tolylhydrazine
Nome do produto |
m-Tolylhydrazine |
Sinônimos |
(3-methyl-phenyl)-hydrazine |
Fórmula molecular |
C7H10N2 |
Peso Molecular |
122.16 |
InChI |
InChI=1/C7H10N2/c1-6-3-2-4-7(5-6)9-8/h2-5,9H,8H2,1H3 |
CAS Registry Number |
536-89-0 |
EINECS |
208-650-9 |
Estrutura Molecular |
|
Densidade |
1.057 |
Símbolos de perigo |
|
Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
|
|