ChemNet > CAS > 58755-70-7 4-Iodo-3-nitroanisole
58755-70-7 4-Iodo-3-nitroanisole
| Nome do produto |
4-Iodo-3-nitroanisole |
| Sinônimos |
1-iodo-4-methoxy-2-nitrobenzene; 3-Nitro-4-iodoanisol |
| Fórmula molecular |
C7H6INO3 |
| Peso Molecular |
279.0319 |
| InChI |
InChI=1/C7H6INO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| CAS Registry Number |
58755-70-7 |
| Estrutura Molecular |
|
| Densidade |
1.893g/cm3 |
| Ponto de ebulição |
330.8°C at 760 mmHg |
| índice de refração |
1.629 |
| O ponto de inflamação |
153.8°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
