ChemNet > CAS > 588-43-2 tributyl orthoformate
588-43-2 tributyl orthoformate
| Nome do produto |
tributyl orthoformate |
| Sinônimos |
1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
| Fórmula molecular |
C13H28O3 |
| Peso Molecular |
232.3596 |
| InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
| CAS Registry Number |
588-43-2 |
| EINECS |
209-618-7 |
| Estrutura Molecular |
|
| Densidade |
0.884g/cm3 |
| Ponto de ebulição |
262.7°C at 760 mmHg |
| índice de refração |
1.427 |
| O ponto de inflamação |
96.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
