ChemNet > CAS > 59463-56-8 cyanomethyl ethanethioate
59463-56-8 cyanomethyl ethanethioate
| Nome do produto |
cyanomethyl ethanethioate |
| Sinônimos |
S-(cyanomethyl) ethanethioate |
| Fórmula molecular |
C4H5NOS |
| Peso Molecular |
115.1536 |
| InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
| CAS Registry Number |
59463-56-8 |
| Estrutura Molecular |
|
| Densidade |
1.162g/cm3 |
| Ponto de ebulição |
198.1°C at 760 mmHg |
| índice de refração |
1.487 |
| O ponto de inflamação |
73.6°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
|
|
