ChemNet > CAS > 63435-16-5 Methyl 4-amino-3-hydroxybenzoate
63435-16-5 Methyl 4-amino-3-hydroxybenzoate
| Nome do produto |
Methyl 4-amino-3-hydroxybenzoate |
| Sinônimos |
4-Amino-3-hydroxybenzoic acid methyl ester |
| Fórmula molecular |
C8H9NO3 |
| Peso Molecular |
167.162 |
| InChI |
InChI=1/C8H9NO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,9H2,1H3 |
| CAS Registry Number |
63435-16-5 |
| Estrutura Molecular |
|
| Densidade |
1.305g/cm3 |
| Ponto de ebulição |
364.5°C at 760 mmHg |
| índice de refração |
1.605 |
| O ponto de inflamação |
174.2°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
