ChemNet > CAS > 64287-19-0 4-Fluoro-3-methoxyacetophenone
64287-19-0 4-Fluoro-3-methoxyacetophenone
| Nome do produto |
4-Fluoro-3-methoxyacetophenone |
| Sinônimos |
1-(4-Fluoro-3-methoxyphenyl)ethanone; Ethanone, 2-amino-1-(2,4-difluorophenyl)-; 4'-Fluoro-3'-methoxyacetophenone |
| Fórmula molecular |
C8H7F2NO |
| Peso Molecular |
171.1441 |
| InChI |
InChI=1/C8H7F2NO/c9-5-1-2-6(7(10)3-5)8(12)4-11/h1-3H,4,11H2 |
| CAS Registry Number |
64287-19-0 |
| Estrutura Molecular |
|
| Densidade |
1.286g/cm3 |
| Ponto de ebulição |
255.9°C at 760 mmHg |
| índice de refração |
1.51 |
| O ponto de inflamação |
108.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
