ChemNet > CAS > 6640-09-1 5-Benzyloxyindole-2-carboxylic acid
6640-09-1 5-Benzyloxyindole-2-carboxylic acid
| Nome do produto |
5-Benzyloxyindole-2-carboxylic acid |
| Sinônimos |
5-(Benzyloxy)-1H-indole-2-carboxylic acid |
| Fórmula molecular |
C16H13NO3 |
| Peso Molecular |
267.2793 |
| InChI |
InChI=1/C16H13NO3/c18-16(19)15-9-12-8-13(6-7-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19) |
| CAS Registry Number |
6640-09-1 |
| EINECS |
229-652-6 |
| Estrutura Molecular |
|
| Densidade |
1.342g/cm3 |
| Ponto de fusão |
192℃ |
| Ponto de ebulição |
531.1°C at 760 mmHg |
| índice de refração |
1.696 |
| O ponto de inflamação |
275°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
