ChemNet > CAS > 75129-74-7 4-Nitrophenoxyacetic acid hydrazide
75129-74-7 4-Nitrophenoxyacetic acid hydrazide
| Nome do produto |
4-Nitrophenoxyacetic acid hydrazide |
| Sinônimos |
Acetic acid, (4-nitrophenoxy)-, hydrazide; 2-(4-nitrophenoxy)acetohydrazide |
| Fórmula molecular |
C8H9N3O4 |
| Peso Molecular |
211.1748 |
| InChI |
InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-3-1-6(2-4-7)11(13)14/h1-4H,5,9H2,(H,10,12) |
| CAS Registry Number |
75129-74-7 |
| Estrutura Molecular |
|
| Densidade |
1.394g/cm3 |
| Ponto de ebulição |
511.9°C at 760 mmHg |
| índice de refração |
1.592 |
| O ponto de inflamação |
263.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
