ChemNet > CAS > 77-79-2 Butadiene sulfone
77-79-2 Butadiene sulfone
| Nome do produto |
Butadiene sulfone |
| Sinônimos |
2,5-Dihydrothiophene-1,1-dioxide; 3-Sulfolene; Dihydrothiophene-1,1-dioxide; Butadiene sulphone; Cyclobutenesulfone |
| Fórmula molecular |
C4H6O2S |
| Peso Molecular |
118.15 |
| InChI |
InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| CAS Registry Number |
77-79-2 |
| EINECS |
201-059-7 |
| Estrutura Molecular |
|
| Densidade |
1.314 |
| Ponto de fusão |
63-66℃ |
| O ponto de inflamação |
112℃ |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
