ChemNet > CAS > 20666-12-0 5-amino-2,3-dihydro-1,4-*phthalazinedione sodium
20666-12-0 5-amino-2,3-dihydro-1,4-*phthalazinedione sodium
Название продукта |
5-amino-2,3-dihydro-1,4-*phthalazinedione sodium |
Синонимы |
3-Aminophthalhydrazide monosodium salt; Luminol monosodium salt~Sodium luminol; 5-amino-2,3-dihydrophthalazine-1,4-dione; 1,4-phthalazinedione, 5-amino-2,3-dihydro-, sodium salt (1:1); 3-aminophthalhydrazidemonosodium salt |
Молекулярная формула |
C8H7N3NaO2 |
Молекулярный вес |
200.1498 |
InChI |
InChI=1/C8H7N3O2.Na/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12;/h1-3H,9H2,(H,10,12)(H,11,13); |
Регистрационный номер CAS |
20666-12-0 |
EINECS |
208-309-4 |
Молекулярная структура |
|
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|