ChemNet > CAS > 220141-71-9 3,5-Difluorobenzylchloride
220141-71-9 3,5-Difluorobenzylchloride
Название продукта |
3,5-Difluorobenzylchloride |
Синонимы |
3,5-Difluorobenzyl chloride; 1-(chloromethyl)-3,5-difluorobenzene |
Молекулярная формула |
C7H5ClF2 |
Молекулярный вес |
162.5644 |
InChI |
InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
Регистрационный номер CAS |
220141-71-9 |
Молекулярная структура |
|
Плотность |
1.294g/cm3 |
Точка кипения |
164.5°C at 760 mmHg |
Показатель преломления |
1.485 |
Температура вспышки |
56.2°C |
Символы опасности |
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|